C13H16O2 — CID 53401972
1-(4-methoxyphenyl)hexa-1,5-dien-3-ol (PubChem CID 53401972) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)hexa-1,5-dien-3-ol.
| Compound Name | 1-(4-methoxyphenyl)hexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 53401972 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1-(4-methoxyphenyl)hexa-1,5-dien-3-ol |
| SMILES | C=CCC(O)C=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H16O2/c1-3-4-12(14)8-5-11-6-9-13(15-2)10-7-11/h3,5-10,12,14H,1,4H2,2H3 |
| InChIKey | NQZFURRAMALGHE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|