C18H16BrN3O4 — CID 21231607
5-[(4-bromoanilino)-(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 21231607) has the molecular formula C18H16BrN3O4 and a molecular weight of 418.25 g/mol. Its IUPAC name is 5-[(4-bromoanilino)-(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-bromoanilino)-(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 21231607 |
| Molecular Formula | C18H16BrN3O4 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 5-[(4-bromoanilino)-(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(C(Nc2ccc(Br)cc2)C2C(=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C18H16BrN3O4/c1-26-13-8-2-10(3-9-13)15(20-12-6-4-11(19)5-7-12)14-16(23)21-18(25)22-17(14)24/h2-9,14-15,20H,1H3,(H2,21,22,23,24,25) |
| InChIKey | DWMSLSUAOSIBQH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|