C20H27N3O4S — CID 138617309
8-[(2S)-2-amino-2,4-dimethylpentoxy]-2-[(sulfinoamino)methyl]-6H-isochromeno[3,4-c]pyridine (PubChem CID 138617309) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is 8-[(2S)-2-amino-2,4-dimethylpentoxy]-2-[(sulfinoamino)methyl]-6H-isochromeno[3,4-c]pyridine.
| Compound Name | 8-[(2S)-2-amino-2,4-dimethylpentoxy]-2-[(sulfinoamino)methyl]-6H-isochromeno[3,4-c]pyridine |
|---|---|
| PubChem CID | 138617309 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 8-[(2S)-2-amino-2,4-dimethylpentoxy]-2-[(sulfinoamino)methyl]-6H-isochromeno[3,4-c]pyridine |
| SMILES | CC(C)C[C@](C)(N)COc1ccc2c(c1)COc1cnc(CNS(=O)O)cc1-2 |
| InChI | InChI=1S/C20H27N3O4S/c1-13(2)8-20(3,21)12-27-16-4-5-17-14(6-16)11-26-19-10-22-15(7-18(17)19)9-23-28(24)25/h4-7,10,13,23H,8-9,11-12,21H2,1-3H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | GNVUHHRMHUXYGJ-FQEVSTJZSA-N |
| XLogP | 3.01 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|