C19H24N2O2 — CID 141445863
1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-2,4-dimethylpentan-2-amine (PubChem CID 141445863) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-2,4-dimethylpentan-2-amine.
| Compound Name | 1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 141445863 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-2,4-dimethylpentan-2-amine |
| SMILES | CC(C)CC(C)(N)COc1ccc2c(c1)OCc1cnccc1-2 |
| InChI | InChI=1S/C19H24N2O2/c1-13(2)9-19(3,20)12-23-15-4-5-17-16-6-7-21-10-14(16)11-22-18(17)8-15/h4-8,10,13H,9,11-12,20H2,1-3H3 |
| InChIKey | QZVJDOPQIOETCO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |