About 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine
8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine (PubChem CID 130389266) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine.
Molecular Properties
| Compound Name | 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine |
| PubChem CID | 130389266 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine |
| SMILES | CC(C)CCCOc1ccc2c(c1)OCc1cnc(N)cc1-2 |
| InChI | InChI=1S/C18H22N2O2/c1-12(2)4-3-7-21-14-5-6-15-16-9-18(19)20-10-13(16)11-22-17(15)8-14/h5-6,8-10,12H,3-4,7,11H2,1-2H3,(H2,19,20) |
| InChIKey | NPEMPBIFJRQNQL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine?
The IUPAC name of 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine (CID 130389266) is 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine.
What is the SMILES notation for 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine?
The canonical SMILES for 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine is CC(C)CCCOc1ccc2c(c1)OCc1cnc(N)cc1-2.
What is the InChIKey of 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine?
The InChIKey is NPEMPBIFJRQNQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-12(2)4-3-7-21-14-5-6-15-16-9-18(19)20-10-13(16)11-22-17(15)8-14/h5-6,8-10,12H,3-4,7,11H2,1-2H3,(H2,19,20).
What are the key properties of 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine?
8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine has a molecular weight of 298.39 g/mol, XLogP of 4.04, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-amine is sourced from PubChem (CID 130389266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).