C22H31N3O5 — CID 144806662
N-[8-(2-amino-1,1-dihydroxy-2,4-dimethylpentoxy)-5H-chromeno[3,4-c]pyridin-2-yl]formamide;ethane (PubChem CID 144806662) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[8-(2-amino-1,1-dihydroxy-2,4-dimethylpentoxy)-5H-chromeno[3,4-c]pyridin-2-yl]formamide;ethane.
| Compound Name | N-[8-(2-amino-1,1-dihydroxy-2,4-dimethylpentoxy)-5H-chromeno[3,4-c]pyridin-2-yl]formamide;ethane |
|---|---|
| PubChem CID | 144806662 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N-[8-(2-amino-1,1-dihydroxy-2,4-dimethylpentoxy)-5H-chromeno[3,4-c]pyridin-2-yl]formamide;ethane |
| SMILES | CC.CC(C)CC(C)(N)C(O)(O)Oc1ccc2c(c1)OCc1cnc(NC=O)cc1-2 |
| InChI | InChI=1S/C20H25N3O5.C2H6/c1-12(2)8-19(3,21)20(25,26)28-14-4-5-15-16-7-18(23-11-24)22-9-13(16)10-27-17(15)6-14;1-2/h4-7,9,11-12,25-26H,8,10,21H2,1-3H3,(H,22,23,24);1-2H3 |
| InChIKey | KXFOIJXZLAVIAQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|