C22H28N2O4 — CID 130389284
propan-2-yl N-[8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-yl]carbamate (PubChem CID 130389284) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is propan-2-yl N-[8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-yl]carbamate.
| Compound Name | propan-2-yl N-[8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-yl]carbamate |
|---|---|
| PubChem CID | 130389284 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | propan-2-yl N-[8-(4-methylpentoxy)-5H-chromeno[3,4-c]pyridin-2-yl]carbamate |
| SMILES | CC(C)CCCOc1ccc2c(c1)OCc1cnc(NC(=O)OC(C)C)cc1-2 |
| InChI | InChI=1S/C22H28N2O4/c1-14(2)6-5-9-26-17-7-8-18-19-11-21(24-22(25)28-15(3)4)23-12-16(19)13-27-20(18)10-17/h7-8,10-12,14-15H,5-6,9,13H2,1-4H3,(H,23,24,25) |
| InChIKey | GVTDAMLVSMTTEZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|