C19H23NO2 — CID 138650721
9-methyl-8-(4-methylpentoxy)-6H-isochromeno[3,4-c]pyridine (PubChem CID 138650721) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 9-methyl-8-(4-methylpentoxy)-6H-isochromeno[3,4-c]pyridine.
| Compound Name | 9-methyl-8-(4-methylpentoxy)-6H-isochromeno[3,4-c]pyridine |
|---|---|
| PubChem CID | 138650721 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 9-methyl-8-(4-methylpentoxy)-6H-isochromeno[3,4-c]pyridine |
| SMILES | Cc1cc2c(cc1OCCCC(C)C)COc1cnccc1-2 |
| InChI | InChI=1S/C19H23NO2/c1-13(2)5-4-8-21-18-10-15-12-22-19-11-20-7-6-16(19)17(15)9-14(18)3/h6-7,9-11,13H,4-5,8,12H2,1-3H3 |
| InChIKey | PZCWFRSHLABUQN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|