C20H18F3N5O2S — CID 138619388
2-[3-[8-amino-6-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-3,3,3-trifluoropropane-1,2-diol (PubChem CID 138619388) has the molecular formula C20H18F3N5O2S and a molecular weight of 449.46 g/mol. Its IUPAC name is 2-[3-[8-amino-6-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-3,3,3-trifluoropropane-1,2-diol.
| Compound Name | 2-[3-[8-amino-6-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-3,3,3-trifluoropropane-1,2-diol |
|---|---|
| PubChem CID | 138619388 |
| Molecular Formula | C20H18F3N5O2S |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2-[3-[8-amino-6-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-3,3,3-trifluoropropane-1,2-diol |
| SMILES | Cc1ncc(-c2cn3c(-c4cc(C(O)(CO)C(F)(F)F)ccc4C)cnc3c(N)n2)s1 |
| InChI | InChI=1S/C20H18F3N5O2S/c1-10-3-4-12(19(30,9-29)20(21,22)23)5-13(10)15-6-26-18-17(24)27-14(8-28(15)18)16-7-25-11(2)31-16/h3-8,29-30H,9H2,1-2H3,(H2,24,27) |
| InChIKey | USVPZTCVTWNVJK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |