(3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid

C7H12FN2O5P — CID 138619558

IUPAC(3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid
SMILESCOc1c(F)cccc1NN.O=P(O)(O)O
InChIInChI=1S/C7H9FN2O.H3O4P/c1-11-7-5(8)3-2-4-6(7)10-9;1-5(2,3)4/h2-4,10H,9H2,1H3;(H3,1,2,3,4)
InChIKeyULZJKPDBPUKESO-UHFFFAOYSA-N
MW254.15 g/mol
LogP0.19
Rot. Bonds2

About (3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid

(3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid (PubChem CID 138619558) has the molecular formula C7H12FN2O5P and a molecular weight of 254.15 g/mol. Its IUPAC name is (3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid.

Molecular Properties

Compound Name(3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid
PubChem CID138619558
Molecular FormulaC7H12FN2O5P
Molecular Weight254.15 g/mol
Exact Mass254.05
IUPAC Name(3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid
SMILESCOc1c(F)cccc1NN.O=P(O)(O)O
InChIInChI=1S/C7H9FN2O.H3O4P/c1-11-7-5(8)3-2-4-6(7)10-9;1-5(2,3)4/h2-4,10H,9H2,1H3;(H3,1,2,3,4)
InChIKeyULZJKPDBPUKESO-UHFFFAOYSA-N
XLogP0.19
TPSA125.04 Ų
H-Bond Donors5
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.15
LogP ≤ 50.19
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid?
The IUPAC name of (3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid (CID 138619558) is (3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid.
What is the SMILES notation for (3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid?
The canonical SMILES for (3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid is COc1c(F)cccc1NN.O=P(O)(O)O.
What is the InChIKey of (3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid?
The InChIKey is ULZJKPDBPUKESO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN2O.H3O4P/c1-11-7-5(8)3-2-4-6(7)10-9;1-5(2,3)4/h2-4,10H,9H2,1H3;(H3,1,2,3,4).
What are the key properties of (3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid?
(3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid has a molecular weight of 254.15 g/mol, XLogP of 0.19, 2 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-2-methoxyphenyl)hydrazine;phosphoric acid is sourced from PubChem (CID 138619558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).