C10H14N2O6 — CID 138619580
(2,3-dimethoxyphenyl)hydrazine;oxalic acid (PubChem CID 138619580) has the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)hydrazine;oxalic acid.
| Compound Name | (2,3-dimethoxyphenyl)hydrazine;oxalic acid |
|---|---|
| PubChem CID | 138619580 |
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (2,3-dimethoxyphenyl)hydrazine;oxalic acid |
| SMILES | COc1cccc(NN)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H12N2O2.C2H2O4/c1-11-7-5-3-4-6(10-9)8(7)12-2;3-1(4)2(5)6/h3-5,10H,9H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | TVDYNFWPYHPWOV-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|