(3-ethylphenyl)hydrazine;sulfuric acid

C8H14N2O4S — CID 138619674

IUPAC(3-ethylphenyl)hydrazine;sulfuric acid
SMILESCCc1cccc(NN)c1.O=S(=O)(O)O
InChIInChI=1S/C8H12N2.H2O4S/c1-2-7-4-3-5-8(6-7)10-9;1-5(2,3)4/h3-6,10H,2,9H2,1H3;(H2,1,2,3,4)
InChIKeyZUBXDILCGJQNLB-UHFFFAOYSA-N
MW234.28 g/mol
LogP0.88
Rot. Bonds2

About (3-ethylphenyl)hydrazine;sulfuric acid

(3-ethylphenyl)hydrazine;sulfuric acid (PubChem CID 138619674) has the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. Its IUPAC name is (3-ethylphenyl)hydrazine;sulfuric acid.

Molecular Properties

Compound Name(3-ethylphenyl)hydrazine;sulfuric acid
PubChem CID138619674
Molecular FormulaC8H14N2O4S
Molecular Weight234.28 g/mol
Exact Mass234.07
IUPAC Name(3-ethylphenyl)hydrazine;sulfuric acid
SMILESCCc1cccc(NN)c1.O=S(=O)(O)O
InChIInChI=1S/C8H12N2.H2O4S/c1-2-7-4-3-5-8(6-7)10-9;1-5(2,3)4/h3-6,10H,2,9H2,1H3;(H2,1,2,3,4)
InChIKeyZUBXDILCGJQNLB-UHFFFAOYSA-N
XLogP0.88
TPSA112.65 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.28
LogP ≤ 50.88
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (3-ethylphenyl)hydrazine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-ethylphenyl)hydrazine;sulfuric acid?
The IUPAC name of (3-ethylphenyl)hydrazine;sulfuric acid (CID 138619674) is (3-ethylphenyl)hydrazine;sulfuric acid.
What is the SMILES notation for (3-ethylphenyl)hydrazine;sulfuric acid?
The canonical SMILES for (3-ethylphenyl)hydrazine;sulfuric acid is CCc1cccc(NN)c1.O=S(=O)(O)O.
What is the InChIKey of (3-ethylphenyl)hydrazine;sulfuric acid?
The InChIKey is ZUBXDILCGJQNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.H2O4S/c1-2-7-4-3-5-8(6-7)10-9;1-5(2,3)4/h3-6,10H,2,9H2,1H3;(H2,1,2,3,4).
What are the key properties of (3-ethylphenyl)hydrazine;sulfuric acid?
(3-ethylphenyl)hydrazine;sulfuric acid has a molecular weight of 234.28 g/mol, XLogP of 0.88, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethylphenyl)hydrazine;sulfuric acid is sourced from PubChem (CID 138619674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).