About (3-ethylphenyl)hydrazine;sulfuric acid
(3-ethylphenyl)hydrazine;sulfuric acid (PubChem CID 138619674) has the molecular formula C8H14N2O4S
and a molecular weight of 234.28 g/mol. Its IUPAC name is (3-ethylphenyl)hydrazine;sulfuric acid.
Molecular Properties
| Compound Name | (3-ethylphenyl)hydrazine;sulfuric acid |
| PubChem CID | 138619674 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (3-ethylphenyl)hydrazine;sulfuric acid |
| SMILES | CCc1cccc(NN)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H12N2.H2O4S/c1-2-7-4-3-5-8(6-7)10-9;1-5(2,3)4/h3-6,10H,2,9H2,1H3;(H2,1,2,3,4) |
| InChIKey | ZUBXDILCGJQNLB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (3-ethylphenyl)hydrazine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethylphenyl)hydrazine;sulfuric acid?
The IUPAC name of (3-ethylphenyl)hydrazine;sulfuric acid (CID 138619674) is (3-ethylphenyl)hydrazine;sulfuric acid.
What is the SMILES notation for (3-ethylphenyl)hydrazine;sulfuric acid?
The canonical SMILES for (3-ethylphenyl)hydrazine;sulfuric acid is CCc1cccc(NN)c1.O=S(=O)(O)O.
What is the InChIKey of (3-ethylphenyl)hydrazine;sulfuric acid?
The InChIKey is ZUBXDILCGJQNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.H2O4S/c1-2-7-4-3-5-8(6-7)10-9;1-5(2,3)4/h3-6,10H,2,9H2,1H3;(H2,1,2,3,4).
What are the key properties of (3-ethylphenyl)hydrazine;sulfuric acid?
(3-ethylphenyl)hydrazine;sulfuric acid has a molecular weight of 234.28 g/mol, XLogP of 0.88, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethylphenyl)hydrazine;sulfuric acid is sourced from PubChem (CID 138619674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).