C24H29BrN2O3 — CID 138621858
4-bromo-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-3-yl]-3-phenylbutanamide (PubChem CID 138621858) has the molecular formula C24H29BrN2O3 and a molecular weight of 473.41 g/mol. Its IUPAC name is 4-bromo-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-3-yl]-3-phenylbutanamide.
| Compound Name | 4-bromo-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-3-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 138621858 |
| Molecular Formula | C24H29BrN2O3 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 4-bromo-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-3-yl]-3-phenylbutanamide |
| SMILES | O=C(CC(CBr)c1ccccc1)NC1CCCN(CC2COc3ccccc3O2)C1 |
| InChI | InChI=1S/C24H29BrN2O3/c25-14-19(18-7-2-1-3-8-18)13-24(28)26-20-9-6-12-27(15-20)16-21-17-29-22-10-4-5-11-23(22)30-21/h1-5,7-8,10-11,19-21H,6,9,12-17H2,(H,26,28) |
| InChIKey | QPOFBRMTRYLZIB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|