C20H26N4O5S — CID 138622728
tert-butyl 4-methylsulfonyl-10-oxospiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-carboxylate (PubChem CID 138622728) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is tert-butyl 4-methylsulfonyl-10-oxospiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-carboxylate.
| Compound Name | tert-butyl 4-methylsulfonyl-10-oxospiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-carboxylate |
|---|---|
| PubChem CID | 138622728 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | tert-butyl 4-methylsulfonyl-10-oxospiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCCCC2)n2c(cc3cnc(S(C)(=O)=O)nc32)C1=O |
| InChI | InChI=1S/C20H26N4O5S/c1-19(2,3)29-18(26)23-12-20(8-6-5-7-9-20)24-14(16(23)25)10-13-11-21-17(22-15(13)24)30(4,27)28/h10-11H,5-9,12H2,1-4H3 |
| InChIKey | VEOKNMGPOIBBDM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |