About 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine
1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine (PubChem CID 138623766) has the molecular formula C24H49N3
and a molecular weight of 379.68 g/mol. Its IUPAC name is 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine.
Molecular Properties
| Compound Name | 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine |
| PubChem CID | 138623766 |
| Molecular Formula | C24H49N3 |
| Molecular Weight | 379.68 g/mol |
| Exact Mass | 379.39 |
| IUPAC Name | 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine |
| SMILES | CC(C)N1CCC(C(C)(C)CCC(C)(C)N2CCN(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C24H49N3/c1-20(2)25-14-10-21(11-15-25)23(6,7)12-13-24(8,9)27-18-16-26(17-19-27)22(3,4)5/h20-21H,10-19H2,1-9H3 |
| InChIKey | RLLKBTORAWAEIL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.68 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine?
The IUPAC name of 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine (CID 138623766) is 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine.
What is the SMILES notation for 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine?
The canonical SMILES for 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine is CC(C)N1CCC(C(C)(C)CCC(C)(C)N2CCN(C(C)(C)C)CC2)CC1.
What is the InChIKey of 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine?
The InChIKey is RLLKBTORAWAEIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H49N3/c1-20(2)25-14-10-21(11-15-25)23(6,7)12-13-24(8,9)27-18-16-26(17-19-27)22(3,4)5/h20-21H,10-19H2,1-9H3.
What are the key properties of 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine?
1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine has a molecular weight of 379.68 g/mol, XLogP of 5.11, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-[2,5-dimethyl-5-(1-propan-2-ylpiperidin-4-yl)hexan-2-yl]piperazine is sourced from PubChem (CID 138623766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).