C33H24N6 — CID 138625411
N-[3-[(Z)-prop-1-enyl]-1-pyridin-2-yl-5-(9-pyridin-2-ylpyrido[2,3-b]indol-6-yl)indol-2-yl]methanimine (PubChem CID 138625411) has the molecular formula C33H24N6 and a molecular weight of 504.60 g/mol. Its IUPAC name is N-[3-[(Z)-prop-1-enyl]-1-pyridin-2-yl-5-(9-pyridin-2-ylpyrido[2,3-b]indol-6-yl)indol-2-yl]methanimine.
| Compound Name | N-[3-[(Z)-prop-1-enyl]-1-pyridin-2-yl-5-(9-pyridin-2-ylpyrido[2,3-b]indol-6-yl)indol-2-yl]methanimine |
|---|---|
| PubChem CID | 138625411 |
| Molecular Formula | C33H24N6 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | N-[3-[(Z)-prop-1-enyl]-1-pyridin-2-yl-5-(9-pyridin-2-ylpyrido[2,3-b]indol-6-yl)indol-2-yl]methanimine |
| SMILES | C=Nc1c(/C=C\C)c2cc(-c3ccc4c(c3)c3cccnc3n4-c3ccccn3)ccc2n1-c1ccccn1 |
| InChI | InChI=1S/C33H24N6/c1-3-9-24-26-20-22(13-15-28(26)38(32(24)34-2)30-11-4-6-17-35-30)23-14-16-29-27(21-23)25-10-8-19-37-33(25)39(29)31-12-5-7-18-36-31/h3-21H,2H2,1H3/b9-3- |
| InChIKey | SPAOJRKQNZQQHB-OQFOIZHKSA-N |
| XLogP | 7.94 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|