C16H10IN3 — CID 134576120
6-iodo-9-pyridin-2-ylpyrido[2,3-b]indole (PubChem CID 134576120) has the molecular formula C16H10IN3 and a molecular weight of 371.18 g/mol. Its IUPAC name is 6-iodo-9-pyridin-2-ylpyrido[2,3-b]indole.
| Compound Name | 6-iodo-9-pyridin-2-ylpyrido[2,3-b]indole |
|---|---|
| PubChem CID | 134576120 |
| Molecular Formula | C16H10IN3 |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 6-iodo-9-pyridin-2-ylpyrido[2,3-b]indole |
| SMILES | Ic1ccc2c(c1)c1cccnc1n2-c1ccccn1 |
| InChI | InChI=1S/C16H10IN3/c17-11-6-7-14-13(10-11)12-4-3-9-19-16(12)20(14)15-5-1-2-8-18-15/h1-10H |
| InChIKey | HBOAQZHNEYOGNX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|