C21H22F3N5O2S — CID 138625425
(2-ethoxyethylamino)-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]methanol (PubChem CID 138625425) has the molecular formula C21H22F3N5O2S and a molecular weight of 465.50 g/mol. Its IUPAC name is (2-ethoxyethylamino)-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]methanol.
| Compound Name | (2-ethoxyethylamino)-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]methanol |
|---|---|
| PubChem CID | 138625425 |
| Molecular Formula | C21H22F3N5O2S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (2-ethoxyethylamino)-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]methanol |
| SMILES | CCOCCNC(O)c1ccc2c(c1)nc(Nc1nc3ccc(C(F)(F)F)cc3s1)n2C |
| InChI | InChI=1S/C21H22F3N5O2S/c1-3-31-9-8-25-18(30)12-4-7-16-15(10-12)26-19(29(16)2)28-20-27-14-6-5-13(21(22,23)24)11-17(14)32-20/h4-7,10-11,18,25,30H,3,8-9H2,1-2H3,(H,26,27,28) |
| InChIKey | SKSFKCREWIPHAL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|