C17H14F2N4O2S — CID 139318131
[2-[(5,6-difluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-methoxymethanol (PubChem CID 139318131) has the molecular formula C17H14F2N4O2S and a molecular weight of 376.39 g/mol. Its IUPAC name is [2-[(5,6-difluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-methoxymethanol.
| Compound Name | [2-[(5,6-difluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-methoxymethanol |
|---|---|
| PubChem CID | 139318131 |
| Molecular Formula | C17H14F2N4O2S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [2-[(5,6-difluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-methoxymethanol |
| SMILES | COC(O)c1ccc2c(c1)nc(Nc1nc3cc(F)c(F)cc3s1)n2C |
| InChI | InChI=1S/C17H14F2N4O2S/c1-23-13-4-3-8(15(24)25-2)5-11(13)20-16(23)22-17-21-12-6-9(18)10(19)7-14(12)26-17/h3-7,15,24H,1-2H3,(H,20,21,22) |
| InChIKey | OXHVDOCXXIKXAZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|