C16H24N2O6S2 — CID 138626087
2-methylsulfonylethyl N-[1-(2-methylphenyl)sulfonylpiperidin-4-yl]carbamate (PubChem CID 138626087) has the molecular formula C16H24N2O6S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-methylsulfonylethyl N-[1-(2-methylphenyl)sulfonylpiperidin-4-yl]carbamate.
| Compound Name | 2-methylsulfonylethyl N-[1-(2-methylphenyl)sulfonylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 138626087 |
| Molecular Formula | C16H24N2O6S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-methylsulfonylethyl N-[1-(2-methylphenyl)sulfonylpiperidin-4-yl]carbamate |
| SMILES | Cc1ccccc1S(=O)(=O)N1CCC(NC(=O)OCCS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H24N2O6S2/c1-13-5-3-4-6-15(13)26(22,23)18-9-7-14(8-10-18)17-16(19)24-11-12-25(2,20)21/h3-6,14H,7-12H2,1-2H3,(H,17,19) |
| InChIKey | PNRWGYUIDDLSKK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |