C26H27ClN8O — CID 138627879
(5R)-5-[4-(4-chlorobenzoyl)piperazin-1-yl]-6-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]hexanenitrile (PubChem CID 138627879) has the molecular formula C26H27ClN8O and a molecular weight of 503.01 g/mol. Its IUPAC name is (5R)-5-[4-(4-chlorobenzoyl)piperazin-1-yl]-6-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]hexanenitrile.
| Compound Name | (5R)-5-[4-(4-chlorobenzoyl)piperazin-1-yl]-6-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]hexanenitrile |
|---|---|
| PubChem CID | 138627879 |
| Molecular Formula | C26H27ClN8O |
| Molecular Weight | 503.01 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | (5R)-5-[4-(4-chlorobenzoyl)piperazin-1-yl]-6-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]hexanenitrile |
| SMILES | N#CCCC[C@H](Cn1cc(-c2ncnc3[nH]ccc23)cn1)N1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H27ClN8O/c27-21-6-4-19(5-7-21)26(36)34-13-11-33(12-14-34)22(3-1-2-9-28)17-35-16-20(15-32-35)24-23-8-10-29-25(23)31-18-30-24/h4-8,10,15-16,18,22H,1-3,11-14,17H2,(H,29,30,31)/t22-/m1/s1 |
| InChIKey | GOSZGFNGAJGECL-JOCHJYFZSA-N |
| XLogP | 4.00 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.01 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|