C25H33N9O — CID 138627884
(5S)-5-[4-(piperidine-1-carbonyl)piperazin-1-yl]-6-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]hexanenitrile (PubChem CID 138627884) has the molecular formula C25H33N9O and a molecular weight of 475.60 g/mol. Its IUPAC name is (5S)-5-[4-(piperidine-1-carbonyl)piperazin-1-yl]-6-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]hexanenitrile.
| Compound Name | (5S)-5-[4-(piperidine-1-carbonyl)piperazin-1-yl]-6-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]hexanenitrile |
|---|---|
| PubChem CID | 138627884 |
| Molecular Formula | C25H33N9O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | (5S)-5-[4-(piperidine-1-carbonyl)piperazin-1-yl]-6-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]hexanenitrile |
| SMILES | N#CCCC[C@@H](Cn1cc(-c2ncnc3[nH]ccc23)cn1)N1CCN(C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C25H33N9O/c26-8-3-2-6-21(31-12-14-33(15-13-31)25(35)32-10-4-1-5-11-32)18-34-17-20(16-30-34)23-22-7-9-27-24(22)29-19-28-23/h7,9,16-17,19,21H,1-6,10-15,18H2,(H,27,28,29)/t21-/m0/s1 |
| InChIKey | JPKAICVCADAJIN-NRFANRHFSA-N |
| XLogP | 3.11 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|