C18H16F2N2O6S — CID 138628337
methyl (3S,4R)-4-(2,4-difluorophenyl)-1-(2-nitrophenyl)sulfonylpyrrolidine-3-carboxylate (PubChem CID 138628337) has the molecular formula C18H16F2N2O6S and a molecular weight of 426.40 g/mol. Its IUPAC name is methyl (3S,4R)-4-(2,4-difluorophenyl)-1-(2-nitrophenyl)sulfonylpyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4R)-4-(2,4-difluorophenyl)-1-(2-nitrophenyl)sulfonylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 138628337 |
| Molecular Formula | C18H16F2N2O6S |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | methyl (3S,4R)-4-(2,4-difluorophenyl)-1-(2-nitrophenyl)sulfonylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])C[C@H]1c1ccc(F)cc1F |
| InChI | InChI=1S/C18H16F2N2O6S/c1-28-18(23)14-10-21(9-13(14)12-7-6-11(19)8-15(12)20)29(26,27)17-5-3-2-4-16(17)22(24)25/h2-8,13-14H,9-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | BVZJRVFZGKYSCP-UONOGXRCSA-N |
| XLogP | 2.45 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|