C26H24FN3O6S — CID 10506271
methyl (2R,3R,3aR,6aR)-2-(4-fluorophenyl)-5-(2-nitrophenyl)sulfonyl-3-phenyl-1,2,3,3a,4,6-hexahydropyrrolo[3,4-b]pyrrole-6a-carboxylate (PubChem CID 10506271) has the molecular formula C26H24FN3O6S and a molecular weight of 525.56 g/mol. Its IUPAC name is methyl (2R,3R,3aR,6aR)-2-(4-fluorophenyl)-5-(2-nitrophenyl)sulfonyl-3-phenyl-1,2,3,3a,4,6-hexahydropyrrolo[3,4-b]pyrrole-6a-carboxylate.
| Compound Name | methyl (2R,3R,3aR,6aR)-2-(4-fluorophenyl)-5-(2-nitrophenyl)sulfonyl-3-phenyl-1,2,3,3a,4,6-hexahydropyrrolo[3,4-b]pyrrole-6a-carboxylate |
|---|---|
| PubChem CID | 10506271 |
| Molecular Formula | C26H24FN3O6S |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | methyl (2R,3R,3aR,6aR)-2-(4-fluorophenyl)-5-(2-nitrophenyl)sulfonyl-3-phenyl-1,2,3,3a,4,6-hexahydropyrrolo[3,4-b]pyrrole-6a-carboxylate |
| SMILES | COC(=O)[C@]12CN(S(=O)(=O)c3ccccc3[N+](=O)[O-])C[C@H]1[C@H](c1ccccc1)[C@H](c1ccc(F)cc1)N2 |
| InChI | InChI=1S/C26H24FN3O6S/c1-36-25(31)26-16-29(37(34,35)22-10-6-5-9-21(22)30(32)33)15-20(26)23(17-7-3-2-4-8-17)24(28-26)18-11-13-19(27)14-12-18/h2-14,20,23-24,28H,15-16H2,1H3/t20-,23-,24-,26-/m0/s1 |
| InChIKey | CWSJMHSFQLTYLQ-VIRINCGLSA-N |
| XLogP | 3.39 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|