C25H21F2N5O3 — CID 138628698
7-amino-1-[4-(2,3-difluorophenoxy)phenyl]-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-5H-pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 138628698) has the molecular formula C25H21F2N5O3 and a molecular weight of 477.47 g/mol. Its IUPAC name is 7-amino-1-[4-(2,3-difluorophenoxy)phenyl]-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-5H-pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 7-amino-1-[4-(2,3-difluorophenoxy)phenyl]-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-5H-pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 138628698 |
| Molecular Formula | C25H21F2N5O3 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 7-amino-1-[4-(2,3-difluorophenoxy)phenyl]-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-5H-pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | C=CC(=O)N1CC[C@H](c2cn(-c3ccc(Oc4cccc(F)c4F)cc3)c3c(N)n[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C25H21F2N5O3/c1-2-20(33)31-11-10-14(12-31)17-13-32(23-21(17)25(34)30-29-24(23)28)15-6-8-16(9-7-15)35-19-5-3-4-18(26)22(19)27/h2-9,13-14H,1,10-12H2,(H2,28,29)(H,30,34)/t14-/m0/s1 |
| InChIKey | BOLOGZZANFXCGK-AWEZNQCLSA-N |
| XLogP | 3.87 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|