C7H12FNO3 — CID 138629004
[(1R,3S,4R)-3-fluoro-4-hydroxycyclohexyl]carbamic acid (PubChem CID 138629004) has the molecular formula C7H12FNO3 and a molecular weight of 177.18 g/mol. Its IUPAC name is [(1R,3S,4R)-3-fluoro-4-hydroxycyclohexyl]carbamic acid.
| Compound Name | [(1R,3S,4R)-3-fluoro-4-hydroxycyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 138629004 |
| Molecular Formula | C7H12FNO3 |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | [(1R,3S,4R)-3-fluoro-4-hydroxycyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CC[C@@H](O)[C@@H](F)C1 |
| InChI | InChI=1S/C7H12FNO3/c8-5-3-4(9-7(11)12)1-2-6(5)10/h4-6,9-10H,1-3H2,(H,11,12)/t4-,5+,6-/m1/s1 |
| InChIKey | XJOGTQCQVCOSNQ-NGJCXOISSA-N |
| XLogP | 0.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |