(3,3-difluoro-2-hydroxycyclohexyl)carbamic acid

C7H11F2NO3 — CID 77271424

IUPAC(3,3-difluoro-2-hydroxycyclohexyl)carbamic acid
SMILESO=C(O)NC1CCCC(F)(F)C1O
InChIInChI=1S/C7H11F2NO3/c8-7(9)3-1-2-4(5(7)11)10-6(12)13/h4-5,10-11H,1-3H2,(H,12,13)
InChIKeyITVINZJNISFWNT-UHFFFAOYSA-N
MW195.16 g/mol
LogP0.80
Rot. Bonds1

About (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid

(3,3-difluoro-2-hydroxycyclohexyl)carbamic acid (PubChem CID 77271424) has the molecular formula C7H11F2NO3 and a molecular weight of 195.16 g/mol. Its IUPAC name is (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid.

Molecular Properties

Compound Name(3,3-difluoro-2-hydroxycyclohexyl)carbamic acid
PubChem CID77271424
Molecular FormulaC7H11F2NO3
Molecular Weight195.16 g/mol
Exact Mass195.07
IUPAC Name(3,3-difluoro-2-hydroxycyclohexyl)carbamic acid
SMILESO=C(O)NC1CCCC(F)(F)C1O
InChIInChI=1S/C7H11F2NO3/c8-7(9)3-1-2-4(5(7)11)10-6(12)13/h4-5,10-11H,1-3H2,(H,12,13)
InChIKeyITVINZJNISFWNT-UHFFFAOYSA-N
XLogP0.80
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.16
LogP ≤ 50.80
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid?
The IUPAC name of (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid (CID 77271424) is (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid.
What is the SMILES notation for (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid?
The canonical SMILES for (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid is O=C(O)NC1CCCC(F)(F)C1O.
What is the InChIKey of (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid?
The InChIKey is ITVINZJNISFWNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO3/c8-7(9)3-1-2-4(5(7)11)10-6(12)13/h4-5,10-11H,1-3H2,(H,12,13).
What are the key properties of (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid?
(3,3-difluoro-2-hydroxycyclohexyl)carbamic acid has a molecular weight of 195.16 g/mol, XLogP of 0.80, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid is sourced from PubChem (CID 77271424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).