C7H11F2NO3 — CID 77271424
(3,3-difluoro-2-hydroxycyclohexyl)carbamic acid (PubChem CID 77271424) has the molecular formula C7H11F2NO3 and a molecular weight of 195.16 g/mol. Its IUPAC name is (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid.
| Compound Name | (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid |
|---|---|
| PubChem CID | 77271424 |
| Molecular Formula | C7H11F2NO3 |
| Molecular Weight | 195.16 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (3,3-difluoro-2-hydroxycyclohexyl)carbamic acid |
| SMILES | O=C(O)NC1CCCC(F)(F)C1O |
| InChI | InChI=1S/C7H11F2NO3/c8-7(9)3-1-2-4(5(7)11)10-6(12)13/h4-5,10-11H,1-3H2,(H,12,13) |
| InChIKey | ITVINZJNISFWNT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |