C27H25N7O2 — CID 138629327
N-[4-[4-amino-1-(2-prop-2-enoyl-2-azabicyclo[2.2.1]heptan-6-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]benzamide (PubChem CID 138629327) has the molecular formula C27H25N7O2 and a molecular weight of 479.54 g/mol. Its IUPAC name is N-[4-[4-amino-1-(2-prop-2-enoyl-2-azabicyclo[2.2.1]heptan-6-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]benzamide.
| Compound Name | N-[4-[4-amino-1-(2-prop-2-enoyl-2-azabicyclo[2.2.1]heptan-6-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 138629327 |
| Molecular Formula | C27H25N7O2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | N-[4-[4-amino-1-(2-prop-2-enoyl-2-azabicyclo[2.2.1]heptan-6-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]benzamide |
| SMILES | C=CC(=O)N1CC2CC1C(n1nc(-c3ccc(NC(=O)c4ccccc4)cc3)c3c(N)ncnc31)C2 |
| InChI | InChI=1S/C27H25N7O2/c1-2-22(35)33-14-16-12-20(33)21(13-16)34-26-23(25(28)29-15-30-26)24(32-34)17-8-10-19(11-9-17)31-27(36)18-6-4-3-5-7-18/h2-11,15-16,20-21H,1,12-14H2,(H,31,36)(H2,28,29,30) |
| InChIKey | OTMRTKWCANGJMN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|