C27H26N6O2 — CID 138629405
1-[6-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one (PubChem CID 138629405) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is 1-[6-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 138629405 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 1-[6-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2CCC1C(n1nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc31)C2 |
| InChI | InChI=1S/C27H26N6O2/c1-2-23(34)32-15-17-8-13-21(32)22(14-17)33-27-24(26(28)29-16-30-27)25(31-33)18-9-11-20(12-10-18)35-19-6-4-3-5-7-19/h2-7,9-12,16-17,21-22H,1,8,13-15H2,(H2,28,29,30) |
| InChIKey | QHDAPGPQGHTXBU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|