C27H20N6O4 — CID 118356802
5-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-prop-2-enoyl-1,3-dihydrocyclopenta[c]pyrrole-4,6-dione (PubChem CID 118356802) has the molecular formula C27H20N6O4 and a molecular weight of 492.50 g/mol. Its IUPAC name is 5-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-prop-2-enoyl-1,3-dihydrocyclopenta[c]pyrrole-4,6-dione.
| Compound Name | 5-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-prop-2-enoyl-1,3-dihydrocyclopenta[c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 118356802 |
| Molecular Formula | C27H20N6O4 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 5-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-prop-2-enoyl-1,3-dihydrocyclopenta[c]pyrrole-4,6-dione |
| SMILES | C=CC(=O)N1CC2=C(C1)C(=O)C(n1nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc31)C2=O |
| InChI | InChI=1S/C27H20N6O4/c1-2-20(34)32-12-18-19(13-32)25(36)23(24(18)35)33-27-21(26(28)29-14-30-27)22(31-33)15-8-10-17(11-9-15)37-16-6-4-3-5-7-16/h2-11,14,23H,1,12-13H2,(H2,28,29,30) |
| InChIKey | JZVXGLQBOGNOLR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 133.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|