C26H26N6O2 — CID 175338957
1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-2-yl]but-3-en-1-one (PubChem CID 175338957) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-2-yl]but-3-en-1-one.
| Compound Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-2-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 175338957 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-2-yl]but-3-en-1-one |
| SMILES | C=CCC(=O)C1NCCCC1n1nc(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C26H26N6O2/c1-2-7-21(33)24-20(10-6-15-28-24)32-26-22(25(27)29-16-30-26)23(31-32)17-11-13-19(14-12-17)34-18-8-4-3-5-9-18/h2-5,8-9,11-14,16,20,24,28H,1,6-7,10,15H2,(H2,27,29,30) |
| InChIKey | FGECWYSNDWYHGE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|