C27H30N6O3 — CID 149312653
1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-1-methoxybut-3-en-1-ol (PubChem CID 149312653) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-1-methoxybut-3-en-1-ol.
| Compound Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-1-methoxybut-3-en-1-ol |
|---|---|
| PubChem CID | 149312653 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-1-methoxybut-3-en-1-ol |
| SMILES | C=CCC(O)(OC)N1CCCC(n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C27H30N6O3/c1-3-15-27(34,35-2)32-16-7-8-20(17-32)33-26-23(25(28)29-18-30-26)24(31-33)19-11-13-22(14-12-19)36-21-9-5-4-6-10-21/h3-6,9-14,18,20,34H,1,7-8,15-17H2,2H3,(H2,28,29,30) |
| InChIKey | XYXLODIPMFNZPD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|