C22H21N6O3S- — CID 175093097
3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-sulfinate (PubChem CID 175093097) has the molecular formula C22H21N6O3S- and a molecular weight of 449.52 g/mol. Its IUPAC name is 3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-sulfinate.
| Compound Name | 3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-sulfinate |
|---|---|
| PubChem CID | 175093097 |
| Molecular Formula | C22H21N6O3S- |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-sulfinate |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)nn2C1CCCN(S(=O)[O-])C1 |
| InChI | InChI=1S/C22H22N6O3S/c23-21-19-20(15-8-10-18(11-9-15)31-17-6-2-1-3-7-17)26-28(22(19)25-14-24-21)16-5-4-12-27(13-16)32(29)30/h1-3,6-11,14,16H,4-5,12-13H2,(H,29,30)(H2,23,24,25)/p-1 |
| InChIKey | XWEFRCNCKPHYPF-UHFFFAOYSA-M |
| XLogP | 3.30 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|