C24H23N6O3S- — CID 67454088
1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]ethenesulfinate (PubChem CID 67454088) has the molecular formula C24H23N6O3S- and a molecular weight of 475.55 g/mol. Its IUPAC name is 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]ethenesulfinate.
| Compound Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]ethenesulfinate |
|---|---|
| PubChem CID | 67454088 |
| Molecular Formula | C24H23N6O3S- |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]ethenesulfinate |
| SMILES | C=C(N1CCCC(n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1)S(=O)[O-] |
| InChI | InChI=1S/C24H24N6O3S/c1-16(34(31)32)29-13-5-6-18(14-29)30-24-21(23(25)26-15-27-24)22(28-30)17-9-11-20(12-10-17)33-19-7-3-2-4-8-19/h2-4,7-12,15,18H,1,5-6,13-14H2,(H,31,32)(H2,25,26,27)/p-1 |
| InChIKey | DJUQAZUIIUAPJK-UHFFFAOYSA-M |
| XLogP | 3.86 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|