C30H35N7O2 — CID 174238224
1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-(diethylaminomethyl)prop-2-en-1-one (PubChem CID 174238224) has the molecular formula C30H35N7O2 and a molecular weight of 525.66 g/mol. Its IUPAC name is 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-(diethylaminomethyl)prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-(diethylaminomethyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 174238224 |
| Molecular Formula | C30H35N7O2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-(diethylaminomethyl)prop-2-en-1-one |
| SMILES | C=C(CN(CC)CC)C(=O)N1CCCC(n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C30H35N7O2/c1-4-35(5-2)18-21(3)30(38)36-17-9-10-23(19-36)37-29-26(28(31)32-20-33-29)27(34-37)22-13-15-25(16-14-22)39-24-11-7-6-8-12-24/h6-8,11-16,20,23H,3-5,9-10,17-19H2,1-2H3,(H2,31,32,33) |
| InChIKey | GFQACRFMBZTOER-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|