C35H30N6O5 — CID 169096634
7-[2-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]prop-2-enoxy]chromen-2-one (PubChem CID 169096634) has the molecular formula C35H30N6O5 and a molecular weight of 614.66 g/mol. Its IUPAC name is 7-[2-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]prop-2-enoxy]chromen-2-one.
| Compound Name | 7-[2-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]prop-2-enoxy]chromen-2-one |
|---|---|
| PubChem CID | 169096634 |
| Molecular Formula | C35H30N6O5 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | 7-[2-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]prop-2-enoxy]chromen-2-one |
| SMILES | C=C(COc1ccc2ccc(=O)oc2c1)C(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C35H30N6O5/c1-22(20-44-28-15-9-23-12-16-30(42)46-29(23)18-28)35(43)40-17-5-6-25(19-40)41-34-31(33(36)37-21-38-34)32(39-41)24-10-13-27(14-11-24)45-26-7-3-2-4-8-26/h2-4,7-16,18,21,25H,1,5-6,17,19-20H2,(H2,36,37,38)/t25-/m1/s1 |
| InChIKey | VFZMMYPTOUAJFR-RUZDIDTESA-N |
| XLogP | 5.77 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|