C24H25N7O3 — CID 151590383
2-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-N-hydroxyacetamide (PubChem CID 151590383) has the molecular formula C24H25N7O3 and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-N-hydroxyacetamide.
| Compound Name | 2-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 151590383 |
| Molecular Formula | C24H25N7O3 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-N-hydroxyacetamide |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)nn2[C@@H]1CCCN(CC(=O)NO)C1 |
| InChI | InChI=1S/C24H25N7O3/c25-23-21-22(16-8-10-19(11-9-16)34-18-6-2-1-3-7-18)28-31(24(21)27-15-26-23)17-5-4-12-30(13-17)14-20(32)29-33/h1-3,6-11,15,17,33H,4-5,12-14H2,(H,29,32)(H2,25,26,27)/t17-/m1/s1 |
| InChIKey | QIJPVOFCDIPNKS-QGZVFWFLSA-N |
| XLogP | 3.01 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|