C27H27N7O3S2 — CID 138632022
N-[2-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine (PubChem CID 138632022) has the molecular formula C27H27N7O3S2 and a molecular weight of 561.69 g/mol. Its IUPAC name is N-[2-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | N-[2-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 138632022 |
| Molecular Formula | C27H27N7O3S2 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | N-[2-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCN3CCN(Cc4ccccc4)S3(=O)=O)n2)c1 |
| InChI | InChI=1S/C27H27N7O3S2/c1-37-22-9-5-8-21(18-22)24-25(34-16-17-38-27(34)31-24)23-10-11-28-26(30-23)29-12-13-32-14-15-33(39(32,35)36)19-20-6-3-2-4-7-20/h2-11,16-18H,12-15,19H2,1H3,(H,28,29,30) |
| InChIKey | IVIOUFGAVRASMG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |