C21H23N7O3S2 — CID 138632025
3-[5-[2-[2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol (PubChem CID 138632025) has the molecular formula C21H23N7O3S2 and a molecular weight of 485.60 g/mol. Its IUPAC name is 3-[5-[2-[2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol.
| Compound Name | 3-[5-[2-[2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol |
|---|---|
| PubChem CID | 138632025 |
| Molecular Formula | C21H23N7O3S2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 3-[5-[2-[2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol |
| SMILES | CN1CCCN(CCNc2nccc(-c3c(-c4cccc(O)c4)nc4sccn34)n2)S1(=O)=O |
| InChI | InChI=1S/C21H23N7O3S2/c1-26-9-3-10-27(33(26,30)31)11-8-23-20-22-7-6-17(24-20)19-18(15-4-2-5-16(29)14-15)25-21-28(19)12-13-32-21/h2,4-7,12-14,29H,3,8-11H2,1H3,(H,22,23,24) |
| InChIKey | JGTDYVHXKFGFRC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |