C24H47IN2O2 — CID 138632657
N-[5-[iodo(methyl)amino]-2,5-dimethylhexan-2-yl]-N,2,2,5,5,7,7-heptamethyl-6-oxooctanamide (PubChem CID 138632657) has the molecular formula C24H47IN2O2 and a molecular weight of 522.56 g/mol. Its IUPAC name is N-[5-[iodo(methyl)amino]-2,5-dimethylhexan-2-yl]-N,2,2,5,5,7,7-heptamethyl-6-oxooctanamide.
| Compound Name | N-[5-[iodo(methyl)amino]-2,5-dimethylhexan-2-yl]-N,2,2,5,5,7,7-heptamethyl-6-oxooctanamide |
|---|---|
| PubChem CID | 138632657 |
| Molecular Formula | C24H47IN2O2 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | N-[5-[iodo(methyl)amino]-2,5-dimethylhexan-2-yl]-N,2,2,5,5,7,7-heptamethyl-6-oxooctanamide |
| SMILES | CN(I)C(C)(C)CCC(C)(C)N(C)C(=O)C(C)(C)CCC(C)(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C24H47IN2O2/c1-20(2,3)18(28)21(4,5)14-15-22(6,7)19(29)26(12)23(8,9)16-17-24(10,11)27(13)25/h14-17H2,1-13H3 |
| InChIKey | LYBIDOPJJBDJSB-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|