C20H34F6O — CID 138507634
2,2,4,4,7,7,9,9-octamethyl-8,8-bis(trifluoromethyl)decan-3-one (PubChem CID 138507634) has the molecular formula C20H34F6O and a molecular weight of 404.48 g/mol. Its IUPAC name is 2,2,4,4,7,7,9,9-octamethyl-8,8-bis(trifluoromethyl)decan-3-one.
| Compound Name | 2,2,4,4,7,7,9,9-octamethyl-8,8-bis(trifluoromethyl)decan-3-one |
|---|---|
| PubChem CID | 138507634 |
| Molecular Formula | C20H34F6O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 2,2,4,4,7,7,9,9-octamethyl-8,8-bis(trifluoromethyl)decan-3-one |
| SMILES | CC(C)(C)C(=O)C(C)(C)CCC(C)(C)C(C(C)(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H34F6O/c1-14(2,3)13(27)16(7,8)11-12-17(9,10)18(15(4,5)6,19(21,22)23)20(24,25)26/h11-12H2,1-10H3 |
| InChIKey | QPOPKTVQZMKEJM-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |