C16H34O18 — CID 174797376
3,3,6,6-tetramethyl-2,2,7,7-tetrakis(trihydroxymethyl)octane-1,1,1,8,8,8-hexol (PubChem CID 174797376) has the molecular formula C16H34O18 and a molecular weight of 514.43 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-2,2,7,7-tetrakis(trihydroxymethyl)octane-1,1,1,8,8,8-hexol.
| Compound Name | 3,3,6,6-tetramethyl-2,2,7,7-tetrakis(trihydroxymethyl)octane-1,1,1,8,8,8-hexol |
|---|---|
| PubChem CID | 174797376 |
| Molecular Formula | C16H34O18 |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 3,3,6,6-tetramethyl-2,2,7,7-tetrakis(trihydroxymethyl)octane-1,1,1,8,8,8-hexol |
| SMILES | CC(C)(CCC(C)(C)C(C(O)(O)O)(C(O)(O)O)C(O)(O)O)C(C(O)(O)O)(C(O)(O)O)C(O)(O)O |
| InChI | InChI=1S/C16H34O18/c1-7(2,9(11(17,18)19,12(20,21)22)13(23,24)25)5-6-8(3,4)10(14(26,27)28,15(29,30)31)16(32,33)34/h17-34H,5-6H2,1-4H3 |
| InChIKey | QNOVRMOHAGBBMH-UHFFFAOYSA-N |
| XLogP | -8.42 |
| TPSA | 364.14 Ų |
| H-Bond Donors | 18 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | -8.42 |
| H-Bond Donors ≤ 5 | 18 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|