C12H26O6 — CID 175737835
2,2,3,3,4,4-hexamethylhexane-1,1,1,6,6,6-hexol (PubChem CID 175737835) has the molecular formula C12H26O6 and a molecular weight of 266.33 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexamethylhexane-1,1,1,6,6,6-hexol.
| Compound Name | 2,2,3,3,4,4-hexamethylhexane-1,1,1,6,6,6-hexol |
|---|---|
| PubChem CID | 175737835 |
| Molecular Formula | C12H26O6 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2,2,3,3,4,4-hexamethylhexane-1,1,1,6,6,6-hexol |
| SMILES | CC(C)(CC(O)(O)O)C(C)(C)C(C)(C)C(O)(O)O |
| InChI | InChI=1S/C12H26O6/c1-8(2,7-11(13,14)15)9(3,4)10(5,6)12(16,17)18/h13-18H,7H2,1-6H3 |
| InChIKey | JSVPNOFZOZUVSS-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|