C31H34ClN3O5 — CID 138633267
(6aS)-3-[4-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-4-oxobutoxy]-2-methoxy-6,6a,7,8,9,10-hexahydro-5H-pyrido[2,1-c][1,4]benzodiazepin-12-one (PubChem CID 138633267) has the molecular formula C31H34ClN3O5 and a molecular weight of 564.08 g/mol. Its IUPAC name is (6aS)-3-[4-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-4-oxobutoxy]-2-methoxy-6,6a,7,8,9,10-hexahydro-5H-pyrido[2,1-c][1,4]benzodiazepin-12-one.
| Compound Name | (6aS)-3-[4-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-4-oxobutoxy]-2-methoxy-6,6a,7,8,9,10-hexahydro-5H-pyrido[2,1-c][1,4]benzodiazepin-12-one |
|---|---|
| PubChem CID | 138633267 |
| Molecular Formula | C31H34ClN3O5 |
| Molecular Weight | 564.08 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | (6aS)-3-[4-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-4-oxobutoxy]-2-methoxy-6,6a,7,8,9,10-hexahydro-5H-pyrido[2,1-c][1,4]benzodiazepin-12-one |
| SMILES | COc1cc2c(cc1OCCCC(=O)N1C[C@@H](CCl)c3c1cc(O)c1ccccc31)NC[C@@H]1CCCCN1C2=O |
| InChI | InChI=1S/C31H34ClN3O5/c1-39-27-13-23-24(33-17-20-7-4-5-11-34(20)31(23)38)14-28(27)40-12-6-10-29(37)35-18-19(16-32)30-22-9-3-2-8-21(22)26(36)15-25(30)35/h2-3,8-9,13-15,19-20,33,36H,4-7,10-12,16-18H2,1H3/t19-,20+/m1/s1 |
| InChIKey | WRYGKYCXYYLNNG-UXHICEINSA-N |
| XLogP | 5.50 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.08 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|