C32H33ClN2O6 — CID 158156801
(6aS)-3-[4-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-4-oxobutoxy]-2-methoxy-5,6a,7,8,9,10-hexahydropyrido[1,2-b][2]benzazepine-6,12-dione (PubChem CID 158156801) has the molecular formula C32H33ClN2O6 and a molecular weight of 577.08 g/mol. Its IUPAC name is (6aS)-3-[4-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-4-oxobutoxy]-2-methoxy-5,6a,7,8,9,10-hexahydropyrido[1,2-b][2]benzazepine-6,12-dione.
| Compound Name | (6aS)-3-[4-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-4-oxobutoxy]-2-methoxy-5,6a,7,8,9,10-hexahydropyrido[1,2-b][2]benzazepine-6,12-dione |
|---|---|
| PubChem CID | 158156801 |
| Molecular Formula | C32H33ClN2O6 |
| Molecular Weight | 577.08 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | (6aS)-3-[4-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-4-oxobutoxy]-2-methoxy-5,6a,7,8,9,10-hexahydropyrido[1,2-b][2]benzazepine-6,12-dione |
| SMILES | COc1cc2c(cc1OCCCC(=O)N1C[C@@H](CCl)c3c1cc(O)c1ccccc31)CC(=O)[C@@H]1CCCCN1C2=O |
| InChI | InChI=1S/C32H33ClN2O6/c1-40-28-15-23-19(13-27(37)24-9-4-5-11-34(24)32(23)39)14-29(28)41-12-6-10-30(38)35-18-20(17-33)31-22-8-3-2-7-21(22)26(36)16-25(31)35/h2-3,7-8,14-16,20,24,36H,4-6,9-13,17-18H2,1H3/t20-,24+/m1/s1 |
| InChIKey | TYPNMRJQYRGVHU-YKSBVNFPSA-N |
| XLogP | 5.20 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.08 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|