C27H27FN4O — CID 138633852
N-cyclobutyl-2-[3-(6-fluoroquinolin-4-yl)cyclohexyl]-3H-benzimidazole-5-carboxamide (PubChem CID 138633852) has the molecular formula C27H27FN4O and a molecular weight of 442.54 g/mol. Its IUPAC name is N-cyclobutyl-2-[3-(6-fluoroquinolin-4-yl)cyclohexyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-cyclobutyl-2-[3-(6-fluoroquinolin-4-yl)cyclohexyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 138633852 |
| Molecular Formula | C27H27FN4O |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | N-cyclobutyl-2-[3-(6-fluoroquinolin-4-yl)cyclohexyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NC1CCC1)c1ccc2nc(C3CCCC(c4ccnc5ccc(F)cc45)C3)[nH]c2c1 |
| InChI | InChI=1S/C27H27FN4O/c28-19-8-10-23-22(15-19)21(11-12-29-23)16-3-1-4-17(13-16)26-31-24-9-7-18(14-25(24)32-26)27(33)30-20-5-2-6-20/h7-12,14-17,20H,1-6,13H2,(H,30,33)(H,31,32) |
| InChIKey | HXRZCNOLGHOMOP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |