C14H13Cl2N3O2 — CID 138634227
2-chloro-6-(4-chlorophenyl)-N-[(2R)-1-hydroxypropan-2-yl]pyrimidine-4-carboxamide (PubChem CID 138634227) has the molecular formula C14H13Cl2N3O2 and a molecular weight of 326.18 g/mol. Its IUPAC name is 2-chloro-6-(4-chlorophenyl)-N-[(2R)-1-hydroxypropan-2-yl]pyrimidine-4-carboxamide.
| Compound Name | 2-chloro-6-(4-chlorophenyl)-N-[(2R)-1-hydroxypropan-2-yl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 138634227 |
| Molecular Formula | C14H13Cl2N3O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2-chloro-6-(4-chlorophenyl)-N-[(2R)-1-hydroxypropan-2-yl]pyrimidine-4-carboxamide |
| SMILES | C[C@H](CO)NC(=O)c1cc(-c2ccc(Cl)cc2)nc(Cl)n1 |
| InChI | InChI=1S/C14H13Cl2N3O2/c1-8(7-20)17-13(21)12-6-11(18-14(16)19-12)9-2-4-10(15)5-3-9/h2-6,8,20H,7H2,1H3,(H,17,21)/t8-/m1/s1 |
| InChIKey | GWWLMFKMCMXUJJ-MRVPVSSYSA-N |
| XLogP | 2.56 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |