About CID 175798578
CID 175798578 (PubChem CID 175798578) has the molecular formula C11H6Cl2KN2O2
and a molecular weight of 308.19 g/mol.
Molecular Properties
| Compound Name | CID 175798578 |
| PubChem CID | 175798578 |
| Molecular Formula | C11H6Cl2KN2O2 |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.94 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cc(-c2ccc(Cl)cc2)nc(Cl)n1.[K] |
| InChI | InChI=1S/C11H6Cl2N2O2.K/c12-7-3-1-6(2-4-7)8-5-9(10(16)17)15-11(13)14-8;/h1-5H,(H,16,17); |
| InChIKey | QDQUHIYEQUIONA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 175798578 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175798578?
The IUPAC name of CID 175798578 (CID 175798578) is not available.
What is the SMILES notation for CID 175798578?
The canonical SMILES for CID 175798578 is O=C(O)c1cc(-c2ccc(Cl)cc2)nc(Cl)n1.[K].
What is the InChIKey of CID 175798578?
The InChIKey is QDQUHIYEQUIONA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl2N2O2.K/c12-7-3-1-6(2-4-7)8-5-9(10(16)17)15-11(13)14-8;/h1-5H,(H,16,17);.
What are the key properties of CID 175798578?
CID 175798578 has a molecular weight of 308.19 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175798578 is sourced from PubChem (CID 175798578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).