C19H18FN5O4 — CID 138635526
N-[(4-fluoro-3-nitrophenyl)methyl]-6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 138635526) has the molecular formula C19H18FN5O4 and a molecular weight of 399.38 g/mol. Its IUPAC name is N-[(4-fluoro-3-nitrophenyl)methyl]-6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-[(4-fluoro-3-nitrophenyl)methyl]-6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 138635526 |
| Molecular Formula | C19H18FN5O4 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[(4-fluoro-3-nitrophenyl)methyl]-6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1oc2ncnc(NC3(C)CC3)c2c1C(=O)NCc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18FN5O4/c1-10-14(15-16(24-19(2)5-6-19)22-9-23-18(15)29-10)17(26)21-8-11-3-4-12(20)13(7-11)25(27)28/h3-4,7,9H,5-6,8H2,1-2H3,(H,21,26)(H,22,23,24) |
| InChIKey | ZZSSUMBGZSTCHU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|