C14H15F4N3OS — CID 138638587
4-[3-fluoro-5-(trifluoromethyl)phenyl]-5-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-amine (PubChem CID 138638587) has the molecular formula C14H15F4N3OS and a molecular weight of 349.35 g/mol. Its IUPAC name is 4-[3-fluoro-5-(trifluoromethyl)phenyl]-5-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[3-fluoro-5-(trifluoromethyl)phenyl]-5-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 138638587 |
| Molecular Formula | C14H15F4N3OS |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 4-[3-fluoro-5-(trifluoromethyl)phenyl]-5-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-amine |
| SMILES | COCCNCc1sc(N)nc1-c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F4N3OS/c1-22-3-2-20-7-11-12(21-13(19)23-11)8-4-9(14(16,17)18)6-10(15)5-8/h4-6,20H,2-3,7H2,1H3,(H2,19,21) |
| InChIKey | UQWMETVZMSQDLO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|